C18H26N2O8 — CID 70090053
(2R)-2-aminopentanedioic acid;3-[carboxymethyl(2-phenylethyl)amino]propanoic acid (PubChem CID 70090053) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is (2R)-2-aminopentanedioic acid;3-[carboxymethyl(2-phenylethyl)amino]propanoic acid.
| Compound Name | (2R)-2-aminopentanedioic acid;3-[carboxymethyl(2-phenylethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70090053 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2R)-2-aminopentanedioic acid;3-[carboxymethyl(2-phenylethyl)amino]propanoic acid |
| SMILES | N[C@H](CCC(=O)O)C(=O)O.O=C(O)CCN(CCc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C13H17NO4.C5H9NO4/c15-12(16)7-9-14(10-13(17)18)8-6-11-4-2-1-3-5-11;6-3(5(9)10)1-2-4(7)8/h1-5H,6-10H2,(H,15,16)(H,17,18);3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.1/s1 |
| InChIKey | DKMKDASCNJGPDK-ZYRQIYSTSA-N |
| XLogP | 0.35 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |