C9H4ClF2O2- — CID 7009355
(E)-3-(2-chloro-3,6-difluorophenyl)prop-2-enoate (PubChem CID 7009355) has the molecular formula C9H4ClF2O2- and a molecular weight of 217.58 g/mol. Its IUPAC name is (E)-3-(2-chloro-3,6-difluorophenyl)prop-2-enoate.
| Compound Name | (E)-3-(2-chloro-3,6-difluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7009355 |
| Molecular Formula | C9H4ClF2O2- |
| Molecular Weight | 217.58 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | (E)-3-(2-chloro-3,6-difluorophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C9H5ClF2O2/c10-9-5(1-4-8(13)14)6(11)2-3-7(9)12/h1-4H,(H,13,14)/p-1/b4-1+ |
| InChIKey | IHWVLAUNJHXFGN-DAFODLJHSA-M |
| XLogP | 1.38 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.58 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|