C26H34N2O7S — CID 70100738
2-[4-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]butanoyl-methylamino]acetic acid (PubChem CID 70100738) has the molecular formula C26H34N2O7S and a molecular weight of 518.63 g/mol. Its IUPAC name is 2-[4-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]butanoyl-methylamino]acetic acid.
| Compound Name | 2-[4-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]butanoyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 70100738 |
| Molecular Formula | C26H34N2O7S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[4-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]butanoyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)CCCNS(=O)(=O)CC1CC(C)(C)Oc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C26H34N2O7S/c1-26(2)15-20(18-36(32,33)27-13-7-10-24(29)28(3)16-25(30)31)22-14-21(11-12-23(22)35-26)34-17-19-8-5-4-6-9-19/h4-6,8-9,11-12,14,20,27H,7,10,13,15-18H2,1-3H3,(H,30,31) |
| InChIKey | JTMSIYHMJYYBTG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|