C26H43N3O7S — CID 152765106
3-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)methylsulfonylamino]propyl N-(2-morpholin-4-ylethyl)carbamate (PubChem CID 152765106) has the molecular formula C26H43N3O7S and a molecular weight of 541.71 g/mol. Its IUPAC name is 3-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)methylsulfonylamino]propyl N-(2-morpholin-4-ylethyl)carbamate.
| Compound Name | 3-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)methylsulfonylamino]propyl N-(2-morpholin-4-ylethyl)carbamate |
|---|---|
| PubChem CID | 152765106 |
| Molecular Formula | C26H43N3O7S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 3-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)methylsulfonylamino]propyl N-(2-morpholin-4-ylethyl)carbamate |
| SMILES | CCCCOc1ccc2c(c1)C(CS(=O)(=O)NCCCOC(=O)NCCN1CCOCC1)CC(C)(C)O2 |
| InChI | InChI=1S/C26H43N3O7S/c1-4-5-14-34-22-7-8-24-23(18-22)21(19-26(2,3)36-24)20-37(31,32)28-9-6-15-35-25(30)27-10-11-29-12-16-33-17-13-29/h7-8,18,21,28H,4-6,9-17,19-20H2,1-3H3,(H,27,30) |
| InChIKey | YGDBKSQGUPHVPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|