C27H30N2O4 — CID 70101432
benzyl N-[2-[(5-hydroxy-2,2-diphenylpentyl)amino]-2-oxoethyl]carbamate (PubChem CID 70101432) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is benzyl N-[2-[(5-hydroxy-2,2-diphenylpentyl)amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[(5-hydroxy-2,2-diphenylpentyl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 70101432 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | benzyl N-[2-[(5-hydroxy-2,2-diphenylpentyl)amino]-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCC(CCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O4/c30-18-10-17-27(23-13-6-2-7-14-23,24-15-8-3-9-16-24)21-29-25(31)19-28-26(32)33-20-22-11-4-1-5-12-22/h1-9,11-16,30H,10,17-21H2,(H,28,32)(H,29,31) |
| InChIKey | QITVHDKMNJSFFK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |