C22H21ClN6O2S — CID 70103788
N-(3-amino-3-iminopropyl)-2-(5-benzamidothiophen-3-yl)-3H-benzimidazole-5-carboxamide;hydrochloride (PubChem CID 70103788) has the molecular formula C22H21ClN6O2S and a molecular weight of 468.97 g/mol. Its IUPAC name is N-(3-amino-3-iminopropyl)-2-(5-benzamidothiophen-3-yl)-3H-benzimidazole-5-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-3-iminopropyl)-2-(5-benzamidothiophen-3-yl)-3H-benzimidazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70103788 |
| Molecular Formula | C22H21ClN6O2S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-(3-amino-3-iminopropyl)-2-(5-benzamidothiophen-3-yl)-3H-benzimidazole-5-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CCNC(=O)c1ccc2nc(-c3csc(NC(=O)c4ccccc4)c3)[nH]c2c1 |
| InChI | InChI=1S/C22H20N6O2S.ClH/c23-18(24)8-9-25-21(29)14-6-7-16-17(10-14)27-20(26-16)15-11-19(31-12-15)28-22(30)13-4-2-1-3-5-13;/h1-7,10-12H,8-9H2,(H3,23,24)(H,25,29)(H,26,27)(H,28,30);1H |
| InChIKey | HAYYGOUKHUNDMS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 136.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|