About 2-aminooxolan-3-one
2-aminooxolan-3-one (PubChem CID 70105580) has the molecular formula C4H7NO2
and a molecular weight of 101.10 g/mol. Its IUPAC name is 2-aminooxolan-3-one.
Molecular Properties
| Compound Name | 2-aminooxolan-3-one |
| PubChem CID | 70105580 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | 2-aminooxolan-3-one |
| SMILES | NC1OCCC1=O |
| InChI | InChI=1S/C4H7NO2/c5-4-3(6)1-2-7-4/h4H,1-2,5H2 |
| InChIKey | CDZOHVBTWGHYKP-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminooxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooxolan-3-one?
The IUPAC name of 2-aminooxolan-3-one (CID 70105580) is 2-aminooxolan-3-one.
What is the SMILES notation for 2-aminooxolan-3-one?
The canonical SMILES for 2-aminooxolan-3-one is NC1OCCC1=O.
What is the InChIKey of 2-aminooxolan-3-one?
The InChIKey is CDZOHVBTWGHYKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c5-4-3(6)1-2-7-4/h4H,1-2,5H2.
What are the key properties of 2-aminooxolan-3-one?
2-aminooxolan-3-one has a molecular weight of 101.10 g/mol, XLogP of -0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooxolan-3-one is sourced from PubChem (CID 70105580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).