C37H42N4O6 — CID 70105782
benzyl (2R)-2-[3-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]propylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 70105782) has the molecular formula C37H42N4O6 and a molecular weight of 638.77 g/mol. Its IUPAC name is benzyl (2R)-2-[3-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]propylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[3-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]propylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70105782 |
| Molecular Formula | C37H42N4O6 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | benzyl (2R)-2-[3-[4-[4-(2-oxo-3,4-dihydroquinolin-1-yl)piperidine-1-carbonyl]phenoxy]propylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(NCCCOc1ccc(C(=O)N2CCC(N3C(=O)CCc4ccccc43)CC2)cc1)[C@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H42N4O6/c42-34-18-15-28-10-4-5-11-32(28)41(34)30-19-23-39(24-20-30)36(44)29-13-16-31(17-14-29)46-25-7-21-38-35(43)33-12-6-22-40(33)37(45)47-26-27-8-2-1-3-9-27/h1-5,8-11,13-14,16-17,30,33H,6-7,12,15,18-26H2,(H,38,43)/t33-/m1/s1 |
| InChIKey | ZYHYSGNYYJSQEB-MGBGTMOVSA-N |
| XLogP | 4.96 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|