C22H27F2N3O — CID 70111080
1-(4-fluorophenyl)-3-[3-[3-(2-fluorophenyl)-2-methylpiperidin-1-yl]propyl]urea (PubChem CID 70111080) has the molecular formula C22H27F2N3O and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-[3-(2-fluorophenyl)-2-methylpiperidin-1-yl]propyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[3-[3-(2-fluorophenyl)-2-methylpiperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 70111080 |
| Molecular Formula | C22H27F2N3O |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-[3-(2-fluorophenyl)-2-methylpiperidin-1-yl]propyl]urea |
| SMILES | CC1C(c2ccccc2F)CCCN1CCCNC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H27F2N3O/c1-16-19(20-6-2-3-8-21(20)24)7-4-14-27(16)15-5-13-25-22(28)26-18-11-9-17(23)10-12-18/h2-3,6,8-12,16,19H,4-5,7,13-15H2,1H3,(H2,25,26,28) |
| InChIKey | KDSDFUSKTWPDMD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|