C24H29F2N3O — CID 68826558
1-(4-fluorophenyl)-3-[3-[(1R,4S,6S)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea (PubChem CID 68826558) has the molecular formula C24H29F2N3O and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-[(1R,4S,6S)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[3-[(1R,4S,6S)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea |
|---|---|
| PubChem CID | 68826558 |
| Molecular Formula | C24H29F2N3O |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-[(1R,4S,6S)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea |
| SMILES | O=C(NCCCN1C[C@H]2CC[C@@H]1[C@H](Cc1ccc(F)cc1)C2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H29F2N3O/c25-20-5-2-17(3-6-20)14-19-15-18-4-11-23(19)29(16-18)13-1-12-27-24(30)28-22-9-7-21(26)8-10-22/h2-3,5-10,18-19,23H,1,4,11-16H2,(H2,27,28,30)/t18-,19+,23+/m0/s1 |
| InChIKey | JMLUWSBAQTVHFC-YCRNBWNJSA-N |
| XLogP | 4.82 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|