C27H27FN4O — CID 59323381
1-(4-cyanophenyl)-3-[3-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]urea (PubChem CID 59323381) has the molecular formula C27H27FN4O and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[3-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[3-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]urea |
|---|---|
| PubChem CID | 59323381 |
| Molecular Formula | C27H27FN4O |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[3-[3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NCCCN2Cc3ccccc3CC2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H27FN4O/c28-24-10-6-20(7-11-24)16-26-17-22-4-1-2-5-23(22)19-32(26)15-3-14-30-27(33)31-25-12-8-21(18-29)9-13-25/h1-2,4-13,26H,3,14-17,19H2,(H2,30,31,33) |
| InChIKey | HKOSCCHFKIYCGN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|