C24H30ClF2N3O — CID 139947744
1-(4-fluorophenyl)-3-[3-[(1R,4R,6R)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea;hydrochloride (PubChem CID 139947744) has the molecular formula C24H30ClF2N3O and a molecular weight of 449.97 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-[(1R,4R,6R)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-3-[3-[(1R,4R,6R)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea;hydrochloride |
|---|---|
| PubChem CID | 139947744 |
| Molecular Formula | C24H30ClF2N3O |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-[(1R,4R,6R)-6-[(4-fluorophenyl)methyl]-2-azabicyclo[2.2.2]octan-2-yl]propyl]urea;hydrochloride |
| SMILES | Cl.O=C(NCCCN1C[C@@H]2CC[C@@H]1[C@@H](Cc1ccc(F)cc1)C2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H29F2N3O.ClH/c25-20-5-2-17(3-6-20)14-19-15-18-4-11-23(19)29(16-18)13-1-12-27-24(30)28-22-9-7-21(26)8-10-22;/h2-3,5-10,18-19,23H,1,4,11-16H2,(H2,27,28,30);1H/t18-,19+,23-;/m1./s1 |
| InChIKey | JKMVQHYOQUSEJZ-KQCMKQOESA-N |
| XLogP | 5.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|