C25H25N2O4+ — CID 7011513
(1S,11S,12R,16S)-14-cyclohexyl-11-(furan-2-carbonyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 7011513) has the molecular formula C25H25N2O4+ and a molecular weight of 417.49 g/mol. Its IUPAC name is (1S,11S,12R,16S)-14-cyclohexyl-11-(furan-2-carbonyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-14-cyclohexyl-11-(furan-2-carbonyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 7011513 |
| Molecular Formula | C25H25N2O4+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (1S,11S,12R,16S)-14-cyclohexyl-11-(furan-2-carbonyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccco1)[C@@H]1[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2[C@H]2c3ccccc3C=C[NH+]12 |
| InChI | InChI=1S/C25H24N2O4/c28-23(18-11-6-14-31-18)22-20-19(21-17-10-5-4-7-15(17)12-13-26(21)22)24(29)27(25(20)30)16-8-2-1-3-9-16/h4-7,10-14,16,19-22H,1-3,8-9H2/p+1/t19-,20+,21+,22-/m0/s1 |
| InChIKey | PUYXGBKMVCVGDK-CBPXPLCBSA-O |
| XLogP | 2.39 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|