C25H31N2O3+ — CID 7472343
(1S,11S,12R,16S)-14-cyclohexyl-11-(2,2-dimethylpropanoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 7472343) has the molecular formula C25H31N2O3+ and a molecular weight of 407.53 g/mol. Its IUPAC name is (1S,11S,12R,16S)-14-cyclohexyl-11-(2,2-dimethylpropanoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-14-cyclohexyl-11-(2,2-dimethylpropanoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 7472343 |
| Molecular Formula | C25H31N2O3+ |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (1S,11S,12R,16S)-14-cyclohexyl-11-(2,2-dimethylpropanoyl)-14-aza-10-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | CC(C)(C)C(=O)[C@@H]1[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2[C@H]2c3ccccc3C=C[NH+]12 |
| InChI | InChI=1S/C25H30N2O3/c1-25(2,3)22(28)21-19-18(20-17-12-8-7-9-15(17)13-14-26(20)21)23(29)27(24(19)30)16-10-5-4-6-11-16/h7-9,12-14,16,18-21H,4-6,10-11H2,1-3H3/p+1/t18-,19+,20+,21-/m0/s1 |
| InChIKey | ULNZVSBWMWLJBK-BQJUDKOJSA-O |
| XLogP | 2.53 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|