C24H32N2O3Si — CID 70120427
2-[[3-[[2-[tert-butyl(dimethyl)silyl]oxy-4-cyanophenyl]methyl]-2-pyridinyl]methyl]butanoic acid (PubChem CID 70120427) has the molecular formula C24H32N2O3Si and a molecular weight of 424.62 g/mol. Its IUPAC name is 2-[[3-[[2-[tert-butyl(dimethyl)silyl]oxy-4-cyanophenyl]methyl]-2-pyridinyl]methyl]butanoic acid.
| Compound Name | 2-[[3-[[2-[tert-butyl(dimethyl)silyl]oxy-4-cyanophenyl]methyl]-2-pyridinyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 70120427 |
| Molecular Formula | C24H32N2O3Si |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[[3-[[2-[tert-butyl(dimethyl)silyl]oxy-4-cyanophenyl]methyl]-2-pyridinyl]methyl]butanoic acid |
| SMILES | CCC(Cc1ncccc1Cc1ccc(C#N)cc1O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H32N2O3Si/c1-7-18(23(27)28)15-21-19(9-8-12-26-21)14-20-11-10-17(16-25)13-22(20)29-30(5,6)24(2,3)4/h8-13,18H,7,14-15H2,1-6H3,(H,27,28) |
| InChIKey | JZDGJEXQYOESPP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|