C9H20NO3PS2 — CID 70128109
2-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-1,2-thiazolidine 1-oxide (PubChem CID 70128109) has the molecular formula C9H20NO3PS2 and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-1,2-thiazolidine 1-oxide.
| Compound Name | 2-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-1,2-thiazolidine 1-oxide |
|---|---|
| PubChem CID | 70128109 |
| Molecular Formula | C9H20NO3PS2 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[butan-2-ylsulfanyl(ethoxy)phosphoryl]-1,2-thiazolidine 1-oxide |
| SMILES | CCOP(=O)(SC(C)CC)N1CCCS1=O |
| InChI | InChI=1S/C9H20NO3PS2/c1-4-9(3)15-14(11,13-5-2)10-7-6-8-16(10)12/h9H,4-8H2,1-3H3 |
| InChIKey | NAOVPBFPZXQBRU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|