C23H16N4O2 — CID 70128127
2-oxo-N-phenyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indole-5-carboxamide (PubChem CID 70128127) has the molecular formula C23H16N4O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-oxo-N-phenyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indole-5-carboxamide.
| Compound Name | 2-oxo-N-phenyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 70128127 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-oxo-N-phenyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1H-indole-5-carboxamide |
| SMILES | O=C1Nc2ccc(C(=O)Nc3ccccc3)cc2C1=Cc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C23H16N4O2/c28-22(26-16-5-2-1-3-6-16)14-8-9-20-18(11-14)19(23(29)27-20)12-15-13-25-21-17(15)7-4-10-24-21/h1-13H,(H,24,25)(H,26,28)(H,27,29) |
| InChIKey | FYAARPYVYLPZJR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|