C18H15ClN2O3S2 — CID 70129891
5-amino-3-(benzenesulfonyl)-N-(3-chlorophenyl)-4-methylthiophene-2-carboxamide (PubChem CID 70129891) has the molecular formula C18H15ClN2O3S2 and a molecular weight of 406.92 g/mol. Its IUPAC name is 5-amino-3-(benzenesulfonyl)-N-(3-chlorophenyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 5-amino-3-(benzenesulfonyl)-N-(3-chlorophenyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 70129891 |
| Molecular Formula | C18H15ClN2O3S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 5-amino-3-(benzenesulfonyl)-N-(3-chlorophenyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1c(N)sc(C(=O)Nc2cccc(Cl)c2)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O3S2/c1-11-16(26(23,24)14-8-3-2-4-9-14)15(25-17(11)20)18(22)21-13-7-5-6-12(19)10-13/h2-10H,20H2,1H3,(H,21,22) |
| InChIKey | IEAPSUZVRDRPBQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |