About (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane
(1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane (PubChem CID 70131256) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane |
| PubChem CID | 70131256 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane |
| SMILES | C1=CCC(CN2[C@@H]3CCC[C@H]2CC3)=C1 |
| InChI | InChI=1S/C13H19N/c1-2-5-11(4-1)10-14-12-6-3-7-13(14)9-8-12/h1-2,4,12-13H,3,5-10H2/t12-,13+ |
| InChIKey | JPKJDOHLYPDYKE-BETUJISGSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane?
The IUPAC name of (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane (CID 70131256) is (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane?
The canonical SMILES for (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane is C1=CCC(CN2[C@@H]3CCC[C@H]2CC3)=C1.
What is the InChIKey of (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane?
The InChIKey is JPKJDOHLYPDYKE-BETUJISGSA-N. The full InChI is InChI=1S/C13H19N/c1-2-5-11(4-1)10-14-12-6-3-7-13(14)9-8-12/h1-2,4,12-13H,3,5-10H2/t12-,13+.
What are the key properties of (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane?
(1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane has a molecular weight of 189.30 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-8-(cyclopenta-1,3-dien-1-ylmethyl)-8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 70131256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).