C23H17N5O — CID 70133381
8-phenyl-2-[N-(1H-pyrrol-3-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70133381) has the molecular formula C23H17N5O and a molecular weight of 379.42 g/mol. Its IUPAC name is 8-phenyl-2-[N-(1H-pyrrol-3-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-phenyl-2-[N-(1H-pyrrol-3-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70133381 |
| Molecular Formula | C23H17N5O |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 8-phenyl-2-[N-(1H-pyrrol-3-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(N(c3ccccc3)c3cc[nH]c3)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H17N5O/c29-21-12-11-17-15-25-23(26-22(17)28(21)19-9-5-2-6-10-19)27(20-13-14-24-16-20)18-7-3-1-4-8-18/h1-16,24H |
| InChIKey | FDUCJIKZKWVIOW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |