C22H28N4O — CID 70138429
9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole-1-carboxamide (PubChem CID 70138429) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole-1-carboxamide.
| Compound Name | 9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole-1-carboxamide |
|---|---|
| PubChem CID | 70138429 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole-1-carboxamide |
| SMILES | C[C@@H]1CN(CCCn2c3ccccc3c3cccc(C(N)=O)c32)C[C@H](C)N1 |
| InChI | InChI=1S/C22H28N4O/c1-15-13-25(14-16(2)24-15)11-6-12-26-20-10-4-3-7-17(20)18-8-5-9-19(21(18)26)22(23)27/h3-5,7-10,15-16,24H,6,11-14H2,1-2H3,(H2,23,27)/t15-,16+ |
| InChIKey | SGNUXJJPJXKNHK-IYBDPMFKSA-N |
| XLogP | 2.97 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |