About 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate
9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate (PubChem CID 70081812) has the molecular formula C21H31N3O5S
and a molecular weight of 437.56 g/mol. Its IUPAC name is 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate.
Molecular Properties
| Compound Name | 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate |
| PubChem CID | 70081812 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate |
| SMILES | CC1CN(CCCn2c3ccccc3c3ccccc32)CC(C)N1.O.O=S(=O)(O)O |
| InChI | InChI=1S/C21H27N3.H2O4S.H2O/c1-16-14-23(15-17(2)22-16)12-7-13-24-20-10-5-3-8-18(20)19-9-4-6-11-21(19)24;1-5(2,3)4;/h3-6,8-11,16-17,22H,7,12-15H2,1-2H3;(H2,1,2,3,4);1H2 |
| InChIKey | LIZRHFJVZGHGKP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate?
The IUPAC name of 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate (CID 70081812) is 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate.
What is the SMILES notation for 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate?
The canonical SMILES for 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate is CC1CN(CCCn2c3ccccc3c3ccccc32)CC(C)N1.O.O=S(=O)(O)O.
What is the InChIKey of 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate?
The InChIKey is LIZRHFJVZGHGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3.H2O4S.H2O/c1-16-14-23(15-17(2)22-16)12-7-13-24-20-10-5-3-8-18(20)19-9-4-6-11-21(19)24;1-5(2,3)4;/h3-6,8-11,16-17,22H,7,12-15H2,1-2H3;(H2,1,2,3,4);1H2.
What are the key properties of 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate?
9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate has a molecular weight of 437.56 g/mol, XLogP of 2.39, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[3-(3,5-dimethylpiperazin-1-yl)propyl]carbazole;sulfuric acid;hydrate is sourced from PubChem (CID 70081812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).