C25H31N3O4 — CID 13131685
(Z)-but-2-enedioic acid;9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole (PubChem CID 13131685) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole.
| Compound Name | (Z)-but-2-enedioic acid;9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole |
|---|---|
| PubChem CID | 13131685 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole |
| SMILES | C[C@@H]1CN(CCCn2c3ccccc3c3ccccc32)C[C@H](C)N1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H27N3.C4H4O4/c1-16-14-23(15-17(2)22-16)12-7-13-24-20-10-5-3-8-18(20)19-9-4-6-11-21(19)24;5-3(6)1-2-4(7)8/h3-6,8-11,16-17,22H,7,12-15H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,17+; |
| InChIKey | BMFGBYYEKMJDAF-GYOUKFEBSA-N |
| XLogP | 3.58 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|