C10H16N6 — CID 70138865
7-N-[1-(dimethylamino)ethyl]pyrazolo[1,5-a]pyrimidine-3,7-diamine (PubChem CID 70138865) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 7-N-[1-(dimethylamino)ethyl]pyrazolo[1,5-a]pyrimidine-3,7-diamine.
| Compound Name | 7-N-[1-(dimethylamino)ethyl]pyrazolo[1,5-a]pyrimidine-3,7-diamine |
|---|---|
| PubChem CID | 70138865 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 7-N-[1-(dimethylamino)ethyl]pyrazolo[1,5-a]pyrimidine-3,7-diamine |
| SMILES | CC(Nc1ccnc2c(N)cnn12)N(C)C |
| InChI | InChI=1S/C10H16N6/c1-7(15(2)3)14-9-4-5-12-10-8(11)6-13-16(9)10/h4-7,14H,11H2,1-3H3 |
| InChIKey | UAXVIDISAOFJFP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|