C22H25F3N4O5S — CID 70142825
2-[N-(benzenesulfonyl)-3-[(1-carbamimidoylpiperidin-4-yl)methoxy]-5-(trifluoromethyl)anilino]acetic acid (PubChem CID 70142825) has the molecular formula C22H25F3N4O5S and a molecular weight of 514.53 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-[(1-carbamimidoylpiperidin-4-yl)methoxy]-5-(trifluoromethyl)anilino]acetic acid.
| Compound Name | 2-[N-(benzenesulfonyl)-3-[(1-carbamimidoylpiperidin-4-yl)methoxy]-5-(trifluoromethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 70142825 |
| Molecular Formula | C22H25F3N4O5S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-[(1-carbamimidoylpiperidin-4-yl)methoxy]-5-(trifluoromethyl)anilino]acetic acid |
| SMILES | [H]/N=C(\N)N1CCC(COc2cc(N(CC(=O)O)S(=O)(=O)c3ccccc3)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H25F3N4O5S/c23-22(24,25)16-10-17(29(13-20(30)31)35(32,33)19-4-2-1-3-5-19)12-18(11-16)34-14-15-6-8-28(9-7-15)21(26)27/h1-5,10-12,15H,6-9,13-14H2,(H3,26,27)(H,30,31) |
| InChIKey | OLYWTYLQWWDJPL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|