About butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium
butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium (PubChem CID 7014283) has the molecular formula C12H18Cl2NO+
and a molecular weight of 263.19 g/mol. Its IUPAC name is butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium.
Molecular Properties
| Compound Name | butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium |
| PubChem CID | 7014283 |
| Molecular Formula | C12H18Cl2NO+ |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium |
| SMILES | CCCC[NH+](C)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H17Cl2NO/c1-3-4-5-15(2)8-9-6-10(13)7-11(14)12(9)16/h6-7,16H,3-5,8H2,1-2H3/p+1 |
| InChIKey | GYWWYEJEUIADAF-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium?
The IUPAC name of butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium (CID 7014283) is butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium.
What is the SMILES notation for butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium?
The canonical SMILES for butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium is CCCC[NH+](C)Cc1cc(Cl)cc(Cl)c1O.
What is the InChIKey of butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium?
The InChIKey is GYWWYEJEUIADAF-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H17Cl2NO/c1-3-4-5-15(2)8-9-6-10(13)7-11(14)12(9)16/h6-7,16H,3-5,8H2,1-2H3/p+1.
What are the key properties of butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium?
butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium has a molecular weight of 263.19 g/mol, XLogP of 2.51, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium is sourced from PubChem (CID 7014283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).