C12H18Cl2NO+ — CID 7014283
butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium (PubChem CID 7014283) has the molecular formula C12H18Cl2NO+ and a molecular weight of 263.19 g/mol. Its IUPAC name is butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium.
| Compound Name | butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 7014283 |
| Molecular Formula | C12H18Cl2NO+ |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | butyl-[(3,5-dichloro-2-hydroxyphenyl)methyl]-methylazanium |
| SMILES | CCCC[NH+](C)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H17Cl2NO/c1-3-4-5-15(2)8-9-6-10(13)7-11(14)12(9)16/h6-7,16H,3-5,8H2,1-2H3/p+1 |
| InChIKey | GYWWYEJEUIADAF-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|