C17H16N2OS — CID 70149287
2-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 70149287) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 70149287 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1cc(C)c(-c2nc3ccc(C(N)=O)cc3s2)c(C)c1 |
| InChI | InChI=1S/C17H16N2OS/c1-9-6-10(2)15(11(3)7-9)17-19-13-5-4-12(16(18)20)8-14(13)21-17/h4-8H,1-3H3,(H2,18,20) |
| InChIKey | PEMGMUHBQFNWKR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |