About 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine
4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine (PubChem CID 70155256) has the molecular formula C16H14BrFN4
and a molecular weight of 361.22 g/mol. Its IUPAC name is 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine |
| PubChem CID | 70155256 |
| Molecular Formula | C16H14BrFN4 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine |
| SMILES | Cc1cc2c(N3CCC4=CCC(F)(Br)C=C43)ncnc2cn1 |
| InChI | InChI=1S/C16H14BrFN4/c1-10-6-12-13(8-19-10)20-9-21-15(12)22-5-3-11-2-4-16(17,18)7-14(11)22/h2,6-9H,3-5H2,1H3 |
| InChIKey | RVLONXXGEFVCCK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine?
The IUPAC name of 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine (CID 70155256) is 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine.
What is the SMILES notation for 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine?
The canonical SMILES for 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine is Cc1cc2c(N3CCC4=CCC(F)(Br)C=C43)ncnc2cn1.
What is the InChIKey of 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine?
The InChIKey is RVLONXXGEFVCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrFN4/c1-10-6-12-13(8-19-10)20-9-21-15(12)22-5-3-11-2-4-16(17,18)7-14(11)22/h2,6-9H,3-5H2,1H3.
What are the key properties of 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine?
4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine has a molecular weight of 361.22 g/mol, XLogP of 3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methylpyrido[3,4-d]pyrimidine is sourced from PubChem (CID 70155256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).