C22H25BrFN3O4 — CID 67650904
4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6,7-bis(2-methoxyethoxy)quinazoline (PubChem CID 67650904) has the molecular formula C22H25BrFN3O4 and a molecular weight of 494.36 g/mol. Its IUPAC name is 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6,7-bis(2-methoxyethoxy)quinazoline.
| Compound Name | 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6,7-bis(2-methoxyethoxy)quinazoline |
|---|---|
| PubChem CID | 67650904 |
| Molecular Formula | C22H25BrFN3O4 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6,7-bis(2-methoxyethoxy)quinazoline |
| SMILES | COCCOc1cc2ncnc(N3CCC4=CCC(F)(Br)C=C43)c2cc1OCCOC |
| InChI | InChI=1S/C22H25BrFN3O4/c1-28-7-9-30-19-11-16-17(12-20(19)31-10-8-29-2)25-14-26-21(16)27-6-4-15-3-5-22(23,24)13-18(15)27/h3,11-14H,4-10H2,1-2H3 |
| InChIKey | USWPOHPLEDEMBO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|