C20H21BrFN3O3 — CID 67651751
4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methoxy-7-(2-methoxyethoxy)quinazoline (PubChem CID 67651751) has the molecular formula C20H21BrFN3O3 and a molecular weight of 450.31 g/mol. Its IUPAC name is 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methoxy-7-(2-methoxyethoxy)quinazoline.
| Compound Name | 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methoxy-7-(2-methoxyethoxy)quinazoline |
|---|---|
| PubChem CID | 67651751 |
| Molecular Formula | C20H21BrFN3O3 |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 4-(6-bromo-6-fluoro-3,5-dihydro-2H-indol-1-yl)-6-methoxy-7-(2-methoxyethoxy)quinazoline |
| SMILES | COCCOc1cc2ncnc(N3CCC4=CCC(F)(Br)C=C43)c2cc1OC |
| InChI | InChI=1S/C20H21BrFN3O3/c1-26-7-8-28-18-10-15-14(9-17(18)27-2)19(24-12-23-15)25-6-4-13-3-5-20(21,22)11-16(13)25/h3,9-12H,4-8H2,1-2H3 |
| InChIKey | BKOBHZAWVXCWTI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|