C34H38O10S2 — CID 70169630
(2S,3R,4R,5S)-1,6-bis[(2-methylphenyl)sulfonyl]-3,4-bis(phenylmethoxy)hexane-1,2,5,6-tetrol (PubChem CID 70169630) has the molecular formula C34H38O10S2 and a molecular weight of 670.80 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1,6-bis[(2-methylphenyl)sulfonyl]-3,4-bis(phenylmethoxy)hexane-1,2,5,6-tetrol.
| Compound Name | (2S,3R,4R,5S)-1,6-bis[(2-methylphenyl)sulfonyl]-3,4-bis(phenylmethoxy)hexane-1,2,5,6-tetrol |
|---|---|
| PubChem CID | 70169630 |
| Molecular Formula | C34H38O10S2 |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.19 |
| IUPAC Name | (2S,3R,4R,5S)-1,6-bis[(2-methylphenyl)sulfonyl]-3,4-bis(phenylmethoxy)hexane-1,2,5,6-tetrol |
| SMILES | Cc1ccccc1S(=O)(=O)C(O)[C@@H](O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)C(O)S(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C34H38O10S2/c1-23-13-9-11-19-27(23)45(39,40)33(37)29(35)31(43-21-25-15-5-3-6-16-25)32(44-22-26-17-7-4-8-18-26)30(36)34(38)46(41,42)28-20-12-10-14-24(28)2/h3-20,29-38H,21-22H2,1-2H3/t29-,30-,31+,32+,33?,34?/m0/s1 |
| InChIKey | ZVZFEAZIFQHNBD-UECDLDDQSA-N |
| XLogP | 3.08 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |