C12H15NO — CID 70181288
5-methoxy-2,3,6-trimethyl-1H-indole (PubChem CID 70181288) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-methoxy-2,3,6-trimethyl-1H-indole.
| Compound Name | 5-methoxy-2,3,6-trimethyl-1H-indole |
|---|---|
| PubChem CID | 70181288 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 5-methoxy-2,3,6-trimethyl-1H-indole |
| SMILES | COc1cc2c(C)c(C)[nH]c2cc1C |
| InChI | InChI=1S/C12H15NO/c1-7-5-11-10(6-12(7)14-4)8(2)9(3)13-11/h5-6,13H,1-4H3 |
| InChIKey | IVCIQJZVSGTVIB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|