C14H17NO — CID 102527727
6-methoxy-7-methyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 102527727) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-methoxy-7-methyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 6-methoxy-7-methyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 102527727 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-methoxy-7-methyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | COc1cc2c3c([nH]c2cc1C)CCCC3 |
| InChI | InChI=1S/C14H17NO/c1-9-7-13-11(8-14(9)16-2)10-5-3-4-6-12(10)15-13/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | VGZSISZOUSPCLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|