C14H19N3O — CID 141006422
2-(2-aminoethoxy)-6,7,8,9-tetrahydro-5H-carbazol-3-amine (PubChem CID 141006422) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-6,7,8,9-tetrahydro-5H-carbazol-3-amine.
| Compound Name | 2-(2-aminoethoxy)-6,7,8,9-tetrahydro-5H-carbazol-3-amine |
|---|---|
| PubChem CID | 141006422 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(2-aminoethoxy)-6,7,8,9-tetrahydro-5H-carbazol-3-amine |
| SMILES | NCCOc1cc2[nH]c3c(c2cc1N)CCCC3 |
| InChI | InChI=1S/C14H19N3O/c15-5-6-18-14-8-13-10(7-11(14)16)9-3-1-2-4-12(9)17-13/h7-8,17H,1-6,15-16H2 |
| InChIKey | JKJHBGGVDMKJTM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 77.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|