C11H12BrN3 — CID 82379783
7-bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine (PubChem CID 82379783) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is 7-bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine.
| Compound Name | 7-bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 82379783 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 7-bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine |
| SMILES | Nc1cc2c3c([nH]c2cc1Br)CCNC3 |
| InChI | InChI=1S/C11H12BrN3/c12-8-4-11-6(3-9(8)13)7-5-14-2-1-10(7)15-11/h3-4,14-15H,1-2,5,13H2 |
| InChIKey | SVIIKSTXSKELLC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|