C33H30ClNO3 — CID 70183022
1-[[4-(2-chloroethoxy)phenyl]methyl]-3-methoxy-8-phenylmethoxy-6,11-dihydro-5H-benzo[a]carbazole (PubChem CID 70183022) has the molecular formula C33H30ClNO3 and a molecular weight of 524.06 g/mol. Its IUPAC name is 1-[[4-(2-chloroethoxy)phenyl]methyl]-3-methoxy-8-phenylmethoxy-6,11-dihydro-5H-benzo[a]carbazole.
| Compound Name | 1-[[4-(2-chloroethoxy)phenyl]methyl]-3-methoxy-8-phenylmethoxy-6,11-dihydro-5H-benzo[a]carbazole |
|---|---|
| PubChem CID | 70183022 |
| Molecular Formula | C33H30ClNO3 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 1-[[4-(2-chloroethoxy)phenyl]methyl]-3-methoxy-8-phenylmethoxy-6,11-dihydro-5H-benzo[a]carbazole |
| SMILES | COc1cc2c(c(Cc3ccc(OCCCl)cc3)c1)-c1[nH]c3ccc(OCc4ccccc4)cc3c1CC2 |
| InChI | InChI=1S/C33H30ClNO3/c1-36-28-18-24-9-13-29-30-20-27(38-21-23-5-3-2-4-6-23)12-14-31(30)35-33(29)32(24)25(19-28)17-22-7-10-26(11-8-22)37-16-15-34/h2-8,10-12,14,18-20,35H,9,13,15-17,21H2,1H3 |
| InChIKey | ASNPQKFVBJPETQ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|