C26H32ClNO3 — CID 70186208
4-[4-amino-5-hydroxy-1-(4-hydroxyphenyl)-3-methyl-7-phenylheptyl]phenol;hydrochloride (PubChem CID 70186208) has the molecular formula C26H32ClNO3 and a molecular weight of 442.00 g/mol. Its IUPAC name is 4-[4-amino-5-hydroxy-1-(4-hydroxyphenyl)-3-methyl-7-phenylheptyl]phenol;hydrochloride.
| Compound Name | 4-[4-amino-5-hydroxy-1-(4-hydroxyphenyl)-3-methyl-7-phenylheptyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 70186208 |
| Molecular Formula | C26H32ClNO3 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-[4-amino-5-hydroxy-1-(4-hydroxyphenyl)-3-methyl-7-phenylheptyl]phenol;hydrochloride |
| SMILES | CC(CC(c1ccc(O)cc1)c1ccc(O)cc1)C(N)C(O)CCc1ccccc1.Cl |
| InChI | InChI=1S/C26H31NO3.ClH/c1-18(26(27)25(30)16-7-19-5-3-2-4-6-19)17-24(20-8-12-22(28)13-9-20)21-10-14-23(29)15-11-21;/h2-6,8-15,18,24-26,28-30H,7,16-17,27H2,1H3;1H |
| InChIKey | JEHKYXJDWQVGBM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |