C11H18MgO4 — CID 70191776
magnesium;2-(cyclopropanecarbonyl)-3,3-dimethylbutanoate;methanolate (PubChem CID 70191776) has the molecular formula C11H18MgO4 and a molecular weight of 238.57 g/mol. Its IUPAC name is magnesium;2-(cyclopropanecarbonyl)-3,3-dimethylbutanoate;methanolate.
| Compound Name | magnesium;2-(cyclopropanecarbonyl)-3,3-dimethylbutanoate;methanolate |
|---|---|
| PubChem CID | 70191776 |
| Molecular Formula | C11H18MgO4 |
| Molecular Weight | 238.57 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | magnesium;2-(cyclopropanecarbonyl)-3,3-dimethylbutanoate;methanolate |
| SMILES | CC(C)(C)C(C(=O)[O-])C(=O)C1CC1.C[O-].[Mg+2] |
| InChI | InChI=1S/C10H16O3.CH3O.Mg/c1-10(2,3)7(9(12)13)8(11)6-4-5-6;1-2;/h6-7H,4-5H2,1-3H3,(H,12,13);1H3;/q;-1;+2/p-1 |
| InChIKey | ULPBRYMUKRZVNR-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.57 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|