About N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron
N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron (PubChem CID 70193525) has the molecular formula C14H13ClFeN2O3S
and a molecular weight of 380.63 g/mol. Its IUPAC name is N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron.
Molecular Properties
| Compound Name | N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron |
| PubChem CID | 70193525 |
| Molecular Formula | C14H13ClFeN2O3S |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2ccc(N)c(Cl)c2)cc1.[Fe] |
| InChI | InChI=1S/C14H13ClN2O3S.Fe/c1-9(18)17-10-2-4-11(5-3-10)21(19,20)12-6-7-14(16)13(15)8-12;/h2-8H,16H2,1H3,(H,17,18); |
| InChIKey | ISGPXPQEZKIPHI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron?
The IUPAC name of N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron (CID 70193525) is N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron.
What is the SMILES notation for N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron?
The canonical SMILES for N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron is CC(=O)Nc1ccc(S(=O)(=O)c2ccc(N)c(Cl)c2)cc1.[Fe].
What is the InChIKey of N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron?
The InChIKey is ISGPXPQEZKIPHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2O3S.Fe/c1-9(18)17-10-2-4-11(5-3-10)21(19,20)12-6-7-14(16)13(15)8-12;/h2-8H,16H2,1H3,(H,17,18);.
What are the key properties of N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron?
N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron has a molecular weight of 380.63 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-amino-3-chlorophenyl)sulfonylphenyl]acetamide;iron is sourced from PubChem (CID 70193525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).