C23H23N3O — CID 70194657
3-amino-6,6-dimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-5H-benzo[b]carbazol-11-one (PubChem CID 70194657) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-amino-6,6-dimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-5H-benzo[b]carbazol-11-one.
| Compound Name | 3-amino-6,6-dimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-5H-benzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 70194657 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-amino-6,6-dimethyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-5H-benzo[b]carbazol-11-one |
| SMILES | CC1(C)c2cc(C3=CCNCC3)ccc2C(=O)c2c1[nH]c1cc(N)ccc21 |
| InChI | InChI=1S/C23H23N3O/c1-23(2)18-11-14(13-7-9-25-10-8-13)3-5-16(18)21(27)20-17-6-4-15(24)12-19(17)26-22(20)23/h3-7,11-12,25-26H,8-10,24H2,1-2H3 |
| InChIKey | ICJNZJBNHXQJSP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|