C23H41N3O4S2 — CID 70211320
5,6-bis[(S)-amino(propylsulfonyl)methyl]-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 70211320) has the molecular formula C23H41N3O4S2 and a molecular weight of 487.73 g/mol. Its IUPAC name is 5,6-bis[(S)-amino(propylsulfonyl)methyl]-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5,6-bis[(S)-amino(propylsulfonyl)methyl]-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 70211320 |
| Molecular Formula | C23H41N3O4S2 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 5,6-bis[(S)-amino(propylsulfonyl)methyl]-N,N-dipropyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCCN(CCC)C1Cc2cc([C@@H](N)S(=O)(=O)CCC)c([C@@H](N)S(=O)(=O)CCC)cc2C1 |
| InChI | InChI=1S/C23H41N3O4S2/c1-5-9-26(10-6-2)19-13-17-15-20(22(24)31(27,28)11-7-3)21(16-18(17)14-19)23(25)32(29,30)12-8-4/h15-16,19,22-23H,5-14,24-25H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | YYCHKQXNRBRERX-GOTSBHOMSA-N |
| XLogP | 2.84 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |