C21H23F3N4O3 — CID 70211364
3-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pentanoic acid (PubChem CID 70211364) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is 3-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pentanoic acid.
| Compound Name | 3-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 70211364 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1cccc(CNC(=O)c2cc(/N=C/NN)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H23F3N4O3/c1-2-14(9-19(29)30)15-5-3-4-13(6-15)11-26-20(31)16-7-17(21(22,23)24)10-18(8-16)27-12-28-25/h3-8,10,12,14H,2,9,11,25H2,1H3,(H,26,31)(H,27,28)(H,29,30) |
| InChIKey | BZENKRSKWHVVNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|