C20H23N3O6 — CID 70211736
but-2-enedioic acid;7-nitro-3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole (PubChem CID 70211736) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is but-2-enedioic acid;7-nitro-3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole.
| Compound Name | but-2-enedioic acid;7-nitro-3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 70211736 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | but-2-enedioic acid;7-nitro-3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
| SMILES | CC(C)N1CC=C(c2c[nH]c3c([N+](=O)[O-])cccc23)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H19N3O2.C4H4O4/c1-11(2)18-8-6-12(7-9-18)14-10-17-16-13(14)4-3-5-15(16)19(20)21;5-3(6)1-2-4(7)8/h3-6,10-11,17H,7-9H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | PUTUMDZJQLVYPW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|