C23H18F3NO3 — CID 70219286
3-(furan-3-yl)-1-[1-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 70219286) has the molecular formula C23H18F3NO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is 3-(furan-3-yl)-1-[1-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 3-(furan-3-yl)-1-[1-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70219286 |
| Molecular Formula | C23H18F3NO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 3-(furan-3-yl)-1-[1-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccoc1)N1CCc2ccccc2C1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H18F3NO3/c24-23(25,26)30-19-8-6-18(7-9-19)22-20-4-2-1-3-17(20)11-13-27(22)21(28)10-5-16-12-14-29-15-16/h1-10,12,14-15,22H,11,13H2 |
| InChIKey | GFENUEKMEJOKQT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|