C26H33O4P — CID 70228642
CID 70228642 (PubChem CID 70228642) has the molecular formula C26H33O4P and a molecular weight of 440.52 g/mol.
| Compound Name | CID 70228642 |
|---|---|
| PubChem CID | 70228642 |
| Molecular Formula | C26H33O4P |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | — |
| SMILES | CCCC(CC1CCCCC1)C(c1ccc(C(=O)O)c(-c2ccccc2C)c1)P(=O)=O |
| InChI | InChI=1S/C26H33O4P/c1-3-9-20(16-19-11-5-4-6-12-19)25(31(29)30)21-14-15-23(26(27)28)24(17-21)22-13-8-7-10-18(22)2/h7-8,10,13-15,17,19-20,25H,3-6,9,11-12,16H2,1-2H3,(H,27,28) |
| InChIKey | GKALFJXPFQPUHO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|