C16H20O4 — CID 70230773
3-(3-cyclopentyloxy-4-methoxyphenyl)-1-methoxyprop-2-yn-1-ol (PubChem CID 70230773) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)-1-methoxyprop-2-yn-1-ol.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-1-methoxyprop-2-yn-1-ol |
|---|---|
| PubChem CID | 70230773 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-1-methoxyprop-2-yn-1-ol |
| SMILES | COc1ccc(C#CC(O)OC)cc1OC1CCCC1 |
| InChI | InChI=1S/C16H20O4/c1-18-14-9-7-12(8-10-16(17)19-2)11-15(14)20-13-5-3-4-6-13/h7,9,11,13,16-17H,3-6H2,1-2H3 |
| InChIKey | YOWUHGNGIRVJPC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|