C24H24ClFO4 — CID 19349946
methyl 5-(4-chloro-3-fluorophenyl)-3-(3-cyclopentyloxy-4-methoxyphenyl)pent-4-ynoate (PubChem CID 19349946) has the molecular formula C24H24ClFO4 and a molecular weight of 430.90 g/mol. Its IUPAC name is methyl 5-(4-chloro-3-fluorophenyl)-3-(3-cyclopentyloxy-4-methoxyphenyl)pent-4-ynoate.
| Compound Name | methyl 5-(4-chloro-3-fluorophenyl)-3-(3-cyclopentyloxy-4-methoxyphenyl)pent-4-ynoate |
|---|---|
| PubChem CID | 19349946 |
| Molecular Formula | C24H24ClFO4 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | methyl 5-(4-chloro-3-fluorophenyl)-3-(3-cyclopentyloxy-4-methoxyphenyl)pent-4-ynoate |
| SMILES | COC(=O)CC(C#Cc1ccc(Cl)c(F)c1)c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C24H24ClFO4/c1-28-22-12-10-17(14-23(22)30-19-5-3-4-6-19)18(15-24(27)29-2)9-7-16-8-11-20(25)21(26)13-16/h8,10-14,18-19H,3-6,15H2,1-2H3 |
| InChIKey | CQTRMXDDXULUNI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|