C30H36N2O5 — CID 19349974
methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-[4-[(2-pyrrolidin-1-ylacetyl)amino]phenyl]pent-4-ynoate (PubChem CID 19349974) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-[4-[(2-pyrrolidin-1-ylacetyl)amino]phenyl]pent-4-ynoate.
| Compound Name | methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-[4-[(2-pyrrolidin-1-ylacetyl)amino]phenyl]pent-4-ynoate |
|---|---|
| PubChem CID | 19349974 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-[4-[(2-pyrrolidin-1-ylacetyl)amino]phenyl]pent-4-ynoate |
| SMILES | COC(=O)CC(C#Cc1ccc(NC(=O)CN2CCCC2)cc1)c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C30H36N2O5/c1-35-27-16-13-23(19-28(27)37-26-7-3-4-8-26)24(20-30(34)36-2)12-9-22-10-14-25(15-11-22)31-29(33)21-32-17-5-6-18-32/h10-11,13-16,19,24,26H,3-8,17-18,20-21H2,1-2H3,(H,31,33) |
| InChIKey | XQPBLQMBZVPNLZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|