C26H29NO4 — CID 54216808
N-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-oxobutanamide (PubChem CID 54216808) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is N-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-oxobutanamide.
| Compound Name | N-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 54216808 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-oxobutanamide |
| SMILES | COc1ccc(C(C#Cc2ccccc2)CNC(=O)CC(C)=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H29NO4/c1-19(28)16-26(29)27-18-22(13-12-20-8-4-3-5-9-20)21-14-15-24(30-2)25(17-21)31-23-10-6-7-11-23/h3-5,8-9,14-15,17,22-23H,6-7,10-11,16,18H2,1-2H3,(H,27,29) |
| InChIKey | PZTHIEJOVQBXCD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|