C25H26N2O2S — CID 54196783
5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-methyl-1,2,4-thiadiazole (PubChem CID 54196783) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 54196783 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-methyl-1,2,4-thiadiazole |
| SMILES | COc1ccc(C(C#Cc2ccccc2)Cc2nc(C)ns2)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H26N2O2S/c1-18-26-25(30-27-18)17-21(13-12-19-8-4-3-5-9-19)20-14-15-23(28-2)24(16-20)29-22-10-6-7-11-22/h3-5,8-9,14-16,21-22H,6-7,10-11,17H2,1-2H3 |
| InChIKey | PMJIQRQOTQCOIR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|